| Name | Ehoxyphenylpiperazine |
| Synonyms | Ehoxyphenylpiperazine LABOTEST-BB LT00233165 1-(2-Ehoxyphenyl)-piperazine 1-(2-ETHOXYPHENYL)PIPERAZINE 1-(2-Ethoxyphenyl)piperazine |
| CAS | 13339-01-0 |
| EINECS | 236-389-0 |
| InChI | InChI=1/C12H18N2O/c1-2-15-12-6-4-3-5-11(12)14-9-7-13-8-10-14/h3-6,13H,2,7-10H2,1H3 |
| Molecular Formula | C12H18N2O |
| Molar Mass | 206.28 |
| Density | 1.04g/cm3 |
| Boling Point | 118 °C |
| Flash Point | 162.2°C |
| Vapor Presure | 6.49E-05mmHg at 25°C |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.528 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R36 - Irritating to the eyes R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| Hazard Note | Irritant |